C12H8Cl2FNO — CID 118813716
[2-(2,4-dichlorophenyl)-3-fluoro-4-pyridinyl]methanol (PubChem CID 118813716) has the molecular formula C12H8Cl2FNO and a molecular weight of 272.11 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-3-fluoro-4-pyridinyl]methanol.
| Compound Name | [2-(2,4-dichlorophenyl)-3-fluoro-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 118813716 |
| Molecular Formula | C12H8Cl2FNO |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-3-fluoro-4-pyridinyl]methanol |
| SMILES | OCc1ccnc(-c2ccc(Cl)cc2Cl)c1F |
| InChI | InChI=1S/C12H8Cl2FNO/c13-8-1-2-9(10(14)5-8)12-11(15)7(6-17)3-4-16-12/h1-5,17H,6H2 |
| InChIKey | LDFAXDXPDIFVMQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |