C16H15ClF3NO — CID 169264773
1-[2-(3-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]propan-2-one;ethane (PubChem CID 169264773) has the molecular formula C16H15ClF3NO and a molecular weight of 329.75 g/mol. Its IUPAC name is 1-[2-(3-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]propan-2-one;ethane.
| Compound Name | 1-[2-(3-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]propan-2-one;ethane |
|---|---|
| PubChem CID | 169264773 |
| Molecular Formula | C16H15ClF3NO |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-[2-(3-chloro-2,4-difluorophenyl)-3-fluoro-4-pyridinyl]propan-2-one;ethane |
| SMILES | CC.CC(=O)Cc1ccnc(-c2ccc(F)c(Cl)c2F)c1F |
| InChI | InChI=1S/C14H9ClF3NO.C2H6/c1-7(20)6-8-4-5-19-14(12(8)17)9-2-3-10(16)11(15)13(9)18;1-2/h2-5H,6H2,1H3;1-2H3 |
| InChIKey | STABLHGABOLQDG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|