C13H9Cl2FO — CID 118807413
[2-(2,4-dichlorophenyl)-5-fluorophenyl]methanol (PubChem CID 118807413) has the molecular formula C13H9Cl2FO and a molecular weight of 271.12 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-5-fluorophenyl]methanol.
| Compound Name | [2-(2,4-dichlorophenyl)-5-fluorophenyl]methanol |
|---|---|
| PubChem CID | 118807413 |
| Molecular Formula | C13H9Cl2FO |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-5-fluorophenyl]methanol |
| SMILES | OCc1cc(F)ccc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H9Cl2FO/c14-9-1-3-12(13(15)6-9)11-4-2-10(16)5-8(11)7-17/h1-6,17H,7H2 |
| InChIKey | FUDPDPRZROZMGF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |