2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid

C14H10Cl2O3 — CID 82040010

IUPAC2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1ccc(-c2cc(Cl)ccc2Cl)cc1
InChIInChI=1S/C14H10Cl2O3/c15-10-5-6-12(16)11(7-10)8-1-3-9(4-2-8)13(17)14(18)19/h1-7,13,17H,(H,18,19)
InChIKeyKAEOJLWSIAJSKU-UHFFFAOYSA-N
MW297.14 g/mol
LogP3.78
Rot. Bonds3

About 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid

2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid (PubChem CID 82040010) has the molecular formula C14H10Cl2O3 and a molecular weight of 297.14 g/mol. Its IUPAC name is 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid
PubChem CID82040010
Molecular FormulaC14H10Cl2O3
Molecular Weight297.14 g/mol
Exact Mass296.00
IUPAC Name2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1ccc(-c2cc(Cl)ccc2Cl)cc1
InChIInChI=1S/C14H10Cl2O3/c15-10-5-6-12(16)11(7-10)8-1-3-9(4-2-8)13(17)14(18)19/h1-7,13,17H,(H,18,19)
InChIKeyKAEOJLWSIAJSKU-UHFFFAOYSA-N
XLogP3.78
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.14
LogP ≤ 53.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid?
The IUPAC name of 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid (CID 82040010) is 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid.
What is the SMILES notation for 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid?
The canonical SMILES for 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid is O=C(O)C(O)c1ccc(-c2cc(Cl)ccc2Cl)cc1.
What is the InChIKey of 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid?
The InChIKey is KAEOJLWSIAJSKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2O3/c15-10-5-6-12(16)11(7-10)8-1-3-9(4-2-8)13(17)14(18)19/h1-7,13,17H,(H,18,19).
What are the key properties of 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid?
2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid has a molecular weight of 297.14 g/mol, XLogP of 3.78, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,5-dichlorophenyl)phenyl]-2-hydroxyacetic acid is sourced from PubChem (CID 82040010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).