C14H8Cl4O3 — CID 134633869
2-[4-chloro-2-(2,4,5-trichlorophenyl)phenyl]-2-hydroxyacetic acid (PubChem CID 134633869) has the molecular formula C14H8Cl4O3 and a molecular weight of 366.03 g/mol. Its IUPAC name is 2-[4-chloro-2-(2,4,5-trichlorophenyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[4-chloro-2-(2,4,5-trichlorophenyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 134633869 |
| Molecular Formula | C14H8Cl4O3 |
| Molecular Weight | 366.03 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 2-[4-chloro-2-(2,4,5-trichlorophenyl)phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc(Cl)cc1-c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl4O3/c15-6-1-2-7(13(19)14(20)21)8(3-6)9-4-11(17)12(18)5-10(9)16/h1-5,13,19H,(H,20,21) |
| InChIKey | MQWMKLVISGTMBW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.03 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|