C8H9ClN2O3 — CID 130779254
2-(5-chloro-2-hydrazinylphenyl)-2-hydroxyacetic acid (PubChem CID 130779254) has the molecular formula C8H9ClN2O3 and a molecular weight of 216.62 g/mol. Its IUPAC name is 2-(5-chloro-2-hydrazinylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(5-chloro-2-hydrazinylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 130779254 |
| Molecular Formula | C8H9ClN2O3 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | 2-(5-chloro-2-hydrazinylphenyl)-2-hydroxyacetic acid |
| SMILES | NNc1ccc(Cl)cc1C(O)C(=O)O |
| InChI | InChI=1S/C8H9ClN2O3/c9-4-1-2-6(11-10)5(3-4)7(12)8(13)14/h1-3,7,11-12H,10H2,(H,13,14) |
| InChIKey | MULLONKWYZANIA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|