About (2,4-dichlorophenyl)hydrazine;methane
(2,4-dichlorophenyl)hydrazine;methane (PubChem CID 54772277) has the molecular formula C7H10Cl2N2
and a molecular weight of 193.08 g/mol. Its IUPAC name is (2,4-dichlorophenyl)hydrazine;methane.
Molecular Properties
| Compound Name | (2,4-dichlorophenyl)hydrazine;methane |
| PubChem CID | 54772277 |
| Molecular Formula | C7H10Cl2N2 |
| Molecular Weight | 193.08 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | (2,4-dichlorophenyl)hydrazine;methane |
| SMILES | C.NNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C6H6Cl2N2.CH4/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H4 |
| InChIKey | KIMWBSZHGBJGFP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.08 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dichlorophenyl)hydrazine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichlorophenyl)hydrazine;methane?
The IUPAC name of (2,4-dichlorophenyl)hydrazine;methane (CID 54772277) is (2,4-dichlorophenyl)hydrazine;methane.
What is the SMILES notation for (2,4-dichlorophenyl)hydrazine;methane?
The canonical SMILES for (2,4-dichlorophenyl)hydrazine;methane is C.NNc1ccc(Cl)cc1Cl.
What is the InChIKey of (2,4-dichlorophenyl)hydrazine;methane?
The InChIKey is KIMWBSZHGBJGFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2N2.CH4/c7-4-1-2-6(10-9)5(8)3-4;/h1-3,10H,9H2;1H4.
What are the key properties of (2,4-dichlorophenyl)hydrazine;methane?
(2,4-dichlorophenyl)hydrazine;methane has a molecular weight of 193.08 g/mol, XLogP of 2.92, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichlorophenyl)hydrazine;methane is sourced from PubChem (CID 54772277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).