C10H10Cl2N6 — CID 80921104
4-N-(2,4-dichlorophenyl)-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80921104) has the molecular formula C10H10Cl2N6 and a molecular weight of 285.14 g/mol. Its IUPAC name is 4-N-(2,4-dichlorophenyl)-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2,4-dichlorophenyl)-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80921104 |
| Molecular Formula | C10H10Cl2N6 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 4-N-(2,4-dichlorophenyl)-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | NNc1cc(Nc2ccc(Cl)cc2Cl)nc(N)n1 |
| InChI | InChI=1S/C10H10Cl2N6/c11-5-1-2-7(6(12)3-5)15-8-4-9(18-14)17-10(13)16-8/h1-4H,14H2,(H4,13,15,16,17,18) |
| InChIKey | VVLQLKBPBBIABC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|