C12H14Cl2N6 — CID 80932264
4-N-[1-(2,4-dichlorophenyl)ethyl]-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80932264) has the molecular formula C12H14Cl2N6 and a molecular weight of 313.19 g/mol. Its IUPAC name is 4-N-[1-(2,4-dichlorophenyl)ethyl]-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[1-(2,4-dichlorophenyl)ethyl]-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80932264 |
| Molecular Formula | C12H14Cl2N6 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-N-[1-(2,4-dichlorophenyl)ethyl]-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | CC(Nc1cc(NN)nc(N)n1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N6/c1-6(8-3-2-7(13)4-9(8)14)17-10-5-11(20-16)19-12(15)18-10/h2-6H,16H2,1H3,(H4,15,17,18,19,20) |
| InChIKey | YWUHALMEFLMLNV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|