C12H15ClN6O2 — CID 80913116
4-N-(4-chloro-2,5-dimethoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine (PubChem CID 80913116) has the molecular formula C12H15ClN6O2 and a molecular weight of 310.75 g/mol. Its IUPAC name is 4-N-(4-chloro-2,5-dimethoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-chloro-2,5-dimethoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80913116 |
| Molecular Formula | C12H15ClN6O2 |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 4-N-(4-chloro-2,5-dimethoxyphenyl)-6-hydrazinylpyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2cc(NN)nc(N)n2)c(OC)cc1Cl |
| InChI | InChI=1S/C12H15ClN6O2/c1-20-8-4-7(9(21-2)3-6(8)13)16-10-5-11(19-15)18-12(14)17-10/h3-5H,15H2,1-2H3,(H4,14,16,17,18,19) |
| InChIKey | HDMQMOALAPXFRZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|