C14H16ClN3O2 — CID 79173822
2-N-(4-chloro-2,5-dimethoxyphenyl)-4-methylpyridine-2,5-diamine (PubChem CID 79173822) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is 2-N-(4-chloro-2,5-dimethoxyphenyl)-4-methylpyridine-2,5-diamine.
| Compound Name | 2-N-(4-chloro-2,5-dimethoxyphenyl)-4-methylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 79173822 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-N-(4-chloro-2,5-dimethoxyphenyl)-4-methylpyridine-2,5-diamine |
| SMILES | COc1cc(Nc2cc(C)c(N)cn2)c(OC)cc1Cl |
| InChI | InChI=1S/C14H16ClN3O2/c1-8-4-14(17-7-10(8)16)18-11-6-12(19-2)9(15)5-13(11)20-3/h4-7H,16H2,1-3H3,(H,17,18) |
| InChIKey | XBJCAVICZQTUEV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |