C6H4Cl3N — CID 134879862
N,2,4-trichloroaniline (PubChem CID 134879862) has the molecular formula C6H4Cl3N and a molecular weight of 196.46 g/mol. Its IUPAC name is N,2,4-trichloroaniline.
| Compound Name | N,2,4-trichloroaniline |
|---|---|
| PubChem CID | 134879862 |
| Molecular Formula | C6H4Cl3N |
| Molecular Weight | 196.46 g/mol |
| Exact Mass | 194.94 |
| IUPAC Name | N,2,4-trichloroaniline |
| SMILES | ClNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C6H4Cl3N/c7-4-1-2-6(10-9)5(8)3-4/h1-3,10H |
| InChIKey | PXOKFKPQXPGUJY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|