C6H4BCl2F4N3 — CID 175412501
2,4-dichloro-1-(diazonioamino)benzene tetrafluoroborate (PubChem CID 175412501) has the molecular formula C6H4BCl2F4N3 and a molecular weight of 275.83 g/mol. Its IUPAC name is 2,4-dichloro-1-(diazonioamino)benzene tetrafluoroborate.
| Compound Name | 2,4-dichloro-1-(diazonioamino)benzene tetrafluoroborate |
|---|---|
| PubChem CID | 175412501 |
| Molecular Formula | C6H4BCl2F4N3 |
| Molecular Weight | 275.83 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 2,4-dichloro-1-(diazonioamino)benzene tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N#[N+]Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C6H4Cl2N3.BF4/c7-4-1-2-6(10-11-9)5(8)3-4;2-1(3,4)5/h1-3,10H;/q+1;-1 |
| InChIKey | PZADBQHBLDYKGU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.83 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|