C6H3Cl2F6N2P — CID 18471224
2,4-dichlorobenzenediazonium hexafluorophosphate (PubChem CID 18471224) has the molecular formula C6H3Cl2F6N2P and a molecular weight of 318.97 g/mol. Its IUPAC name is 2,4-dichlorobenzenediazonium hexafluorophosphate.
| Compound Name | 2,4-dichlorobenzenediazonium hexafluorophosphate |
|---|---|
| PubChem CID | 18471224 |
| Molecular Formula | C6H3Cl2F6N2P |
| Molecular Weight | 318.97 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 2,4-dichlorobenzenediazonium hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.N#[N+]c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C6H3Cl2N2.F6P/c7-4-1-2-6(10-9)5(8)3-4;1-7(2,3,4,5)6/h1-3H;/q+1;-1 |
| InChIKey | JQUSSCUJWAKZFH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.97 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|