C16H10Cl2N2O6S2 — CID 19908751
2,4-dichlorobenzenediazonium;5-sulfonaphthalene-1-sulfonate (PubChem CID 19908751) has the molecular formula C16H10Cl2N2O6S2 and a molecular weight of 461.30 g/mol. Its IUPAC name is 2,4-dichlorobenzenediazonium;5-sulfonaphthalene-1-sulfonate.
| Compound Name | 2,4-dichlorobenzenediazonium;5-sulfonaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 19908751 |
| Molecular Formula | C16H10Cl2N2O6S2 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 459.94 |
| IUPAC Name | 2,4-dichlorobenzenediazonium;5-sulfonaphthalene-1-sulfonate |
| SMILES | N#[N+]c1ccc(Cl)cc1Cl.O=S(=O)([O-])c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C10H8O6S2.C6H3Cl2N2/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;7-4-1-2-6(10-9)5(8)3-4/h1-6H,(H,11,12,13)(H,14,15,16);1-3H/q;+1/p-1 |
| InChIKey | DBSHZQPPSDPIMP-UHFFFAOYSA-M |
| XLogP | 4.47 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|