C10H8NO6S2- — CID 5143627
3-amino-5-sulfonaphthalene-1-sulfonate (PubChem CID 5143627) has the molecular formula C10H8NO6S2- and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-amino-5-sulfonaphthalene-1-sulfonate.
| Compound Name | 3-amino-5-sulfonaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 5143627 |
| Molecular Formula | C10H8NO6S2- |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 3-amino-5-sulfonaphthalene-1-sulfonate |
| SMILES | Nc1cc(S(=O)(=O)[O-])c2cccc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C10H9NO6S2/c11-6-4-8-7(10(5-6)19(15,16)17)2-1-3-9(8)18(12,13)14/h1-5H,11H2,(H,12,13,14)(H,15,16,17)/p-1 |
| InChIKey | MTJGVAJYTOXFJH-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|