C10H8Na2O6S2 — CID 87069218
1,5-Naphthalene disulfonic acid,sodium salt (PubChem CID 87069218) has the molecular formula C10H8Na2O6S2 and a molecular weight of 334.28 g/mol.
| Compound Name | 1,5-Naphthalene disulfonic acid,sodium salt |
|---|---|
| PubChem CID | 87069218 |
| Molecular Formula | C10H8Na2O6S2 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cccc2c(S(=O)(=O)O)cccc12.[Na].[Na] |
| InChI | InChI=1S/C10H8O6S2.2Na/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16;;/h1-6H,(H,11,12,13)(H,14,15,16);; |
| InChIKey | DZPDBGURMVIGOL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|