C10H7O6S2- — CID 3517121
5-sulfonaphthalene-1-sulfonate (PubChem CID 3517121) has the molecular formula C10H7O6S2- and a molecular weight of 287.29 g/mol. Its IUPAC name is 5-sulfonaphthalene-1-sulfonate.
| Compound Name | 5-sulfonaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 3517121 |
| Molecular Formula | C10H7O6S2- |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 5-sulfonaphthalene-1-sulfonate |
| SMILES | O=S(=O)([O-])c1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C10H8O6S2/c11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h1-6H,(H,11,12,13)(H,14,15,16)/p-1 |
| InChIKey | XTEGVFVZDVNBPF-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|