About sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid
sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid (PubChem CID 174624723) has the molecular formula C32H19NaO6S2
and a molecular weight of 586.62 g/mol. Its IUPAC name is sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid.
Molecular Properties
| Compound Name | sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid |
| PubChem CID | 174624723 |
| Molecular Formula | C32H19NaO6S2 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2ccc3cccc4ccc1c2c34.O=S(=O)([O-])c1ccc2ccc3cccc4ccc1c2c34.[Na+] |
| InChI | InChI=1S/2C16H10O3S.Na/c2*17-20(18,19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;/h2*1-9H,(H,17,18,19);/q;;+1/p-1 |
| InChIKey | BLXSIMYHHJLWTL-UHFFFAOYSA-M |
| XLogP | 4.32 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid?
The IUPAC name of sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid (CID 174624723) is sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid.
What is the SMILES notation for sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid?
The canonical SMILES for sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid is O=S(=O)(O)c1ccc2ccc3cccc4ccc1c2c34.O=S(=O)([O-])c1ccc2ccc3cccc4ccc1c2c34.[Na+].
What is the InChIKey of sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid?
The InChIKey is BLXSIMYHHJLWTL-UHFFFAOYSA-M. The full InChI is InChI=1S/2C16H10O3S.Na/c2*17-20(18,19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;/h2*1-9H,(H,17,18,19);/q;;+1/p-1.
What are the key properties of sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid?
sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid has a molecular weight of 586.62 g/mol, XLogP of 4.32, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;pyrene-1-sulfonate;pyrene-1-sulfonic acid is sourced from PubChem (CID 174624723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).