C14H8Na2O6S2 — CID 87786614
disodium;anthracene-1,5-disulfonate (PubChem CID 87786614) has the molecular formula C14H8Na2O6S2 and a molecular weight of 382.33 g/mol. Its IUPAC name is disodium;anthracene-1,5-disulfonate.
| Compound Name | disodium;anthracene-1,5-disulfonate |
|---|---|
| PubChem CID | 87786614 |
| Molecular Formula | C14H8Na2O6S2 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | disodium;anthracene-1,5-disulfonate |
| SMILES | O=S(=O)([O-])c1cccc2cc3c(S(=O)(=O)[O-])cccc3cc12.[Na+].[Na+] |
| InChI | InChI=1S/C14H10O6S2.2Na/c15-21(16,17)13-5-1-3-9-7-12-10(8-11(9)13)4-2-6-14(12)22(18,19)20;;/h1-8H,(H,15,16,17)(H,18,19,20);;/q;2*+1/p-2 |
| InChIKey | FTOKVUPUJBESFC-UHFFFAOYSA-L |
| XLogP | -4.19 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|