About disodium;naphthalene-1,6-disulfonate
disodium;naphthalene-1,6-disulfonate (PubChem CID 45358177) has the molecular formula C10H6Na2O6S2
and a molecular weight of 332.27 g/mol. Its IUPAC name is disodium;naphthalene-1,6-disulfonate.
Molecular Properties
| Compound Name | disodium;naphthalene-1,6-disulfonate |
| PubChem CID | 45358177 |
| Molecular Formula | C10H6Na2O6S2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | disodium;naphthalene-1,6-disulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(S(=O)(=O)[O-])cccc2c1.[Na+].[Na+] |
| InChI | InChI=1S/C10H8O6S2.2Na/c11-17(12,13)8-4-5-9-7(6-8)2-1-3-10(9)18(14,15)16;;/h1-6H,(H,11,12,13)(H,14,15,16);;/q;2*+1/p-2 |
| InChIKey | FXJFYEOXUWERCL-UHFFFAOYSA-L |
| XLogP | -5.34 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | -5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze disodium;naphthalene-1,6-disulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;naphthalene-1,6-disulfonate?
The IUPAC name of disodium;naphthalene-1,6-disulfonate (CID 45358177) is disodium;naphthalene-1,6-disulfonate.
What is the SMILES notation for disodium;naphthalene-1,6-disulfonate?
The canonical SMILES for disodium;naphthalene-1,6-disulfonate is O=S(=O)([O-])c1ccc2c(S(=O)(=O)[O-])cccc2c1.[Na+].[Na+].
What is the InChIKey of disodium;naphthalene-1,6-disulfonate?
The InChIKey is FXJFYEOXUWERCL-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H8O6S2.2Na/c11-17(12,13)8-4-5-9-7(6-8)2-1-3-10(9)18(14,15)16;;/h1-6H,(H,11,12,13)(H,14,15,16);;/q;2*+1/p-2.
What are the key properties of disodium;naphthalene-1,6-disulfonate?
disodium;naphthalene-1,6-disulfonate has a molecular weight of 332.27 g/mol, XLogP of -5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;naphthalene-1,6-disulfonate is sourced from PubChem (CID 45358177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).