C52H78CaO6S2 — CID 101324593
calcium bis(6,7-dioctylnaphthalene-1-sulfonate) (PubChem CID 101324593) has the molecular formula C52H78CaO6S2 and a molecular weight of 903.40 g/mol. Its IUPAC name is calcium bis(6,7-dioctylnaphthalene-1-sulfonate).
| Compound Name | calcium bis(6,7-dioctylnaphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 101324593 |
| Molecular Formula | C52H78CaO6S2 |
| Molecular Weight | 903.40 g/mol |
| Exact Mass | 902.49 |
| IUPAC Name | calcium bis(6,7-dioctylnaphthalene-1-sulfonate) |
| SMILES | CCCCCCCCc1cc2cccc(S(=O)(=O)[O-])c2cc1CCCCCCCC.CCCCCCCCc1cc2cccc(S(=O)(=O)[O-])c2cc1CCCCCCCC.[Ca+2] |
| InChI | InChI=1S/2C26H40O3S.Ca/c2*1-3-5-7-9-11-13-16-22-20-24-18-15-19-26(30(27,28)29)25(24)21-23(22)17-14-12-10-8-6-4-2;/h2*15,18-21H,3-14,16-17H2,1-2H3,(H,27,28,29);/q;;+2/p-2 |
| InChIKey | VPDBCCZJHRZWAY-UHFFFAOYSA-L |
| XLogP | 14.72 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.40 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|