C36H46CaO6S2 — CID 101325277
calcium bis(3,8-dibutylnaphthalene-2-sulfonate) (PubChem CID 101325277) has the molecular formula C36H46CaO6S2 and a molecular weight of 678.97 g/mol. Its IUPAC name is calcium bis(3,8-dibutylnaphthalene-2-sulfonate).
| Compound Name | calcium bis(3,8-dibutylnaphthalene-2-sulfonate) |
|---|---|
| PubChem CID | 101325277 |
| Molecular Formula | C36H46CaO6S2 |
| Molecular Weight | 678.97 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | calcium bis(3,8-dibutylnaphthalene-2-sulfonate) |
| SMILES | CCCCc1cc2cccc(CCCC)c2cc1S(=O)(=O)[O-].CCCCc1cc2cccc(CCCC)c2cc1S(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C18H24O3S.Ca/c2*1-3-5-8-14-10-7-11-15-12-16(9-6-4-2)18(13-17(14)15)22(19,20)21;/h2*7,10-13H,3-6,8-9H2,1-2H3,(H,19,20,21);/q;;+2/p-2 |
| InChIKey | XQLVMCQHCNRDKB-UHFFFAOYSA-L |
| XLogP | 8.48 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.97 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|