sodium 3,8-dibutylnaphthalene-2-sulfonate

C18H23NaO3S — CID 101324984

IUPACsodium 3,8-dibutylnaphthalene-2-sulfonate
SMILESCCCCc1cc2cccc(CCCC)c2cc1S(=O)(=O)[O-].[Na+]
InChIInChI=1S/C18H24O3S.Na/c1-3-5-8-14-10-7-11-15-12-16(9-6-4-2)18(13-17(14)15)22(19,20)21;/h7,10-13H,3-6,8-9H2,1-2H3,(H,19,20,21);/q;+1/p-1
InChIKeyRIZZTXOIDNCRPO-UHFFFAOYSA-M
MW342.44 g/mol
LogP1.43
Rot. Bonds7

About sodium 3,8-dibutylnaphthalene-2-sulfonate

sodium 3,8-dibutylnaphthalene-2-sulfonate (PubChem CID 101324984) has the molecular formula C18H23NaO3S and a molecular weight of 342.44 g/mol. Its IUPAC name is sodium 3,8-dibutylnaphthalene-2-sulfonate.

Molecular Properties

Compound Namesodium 3,8-dibutylnaphthalene-2-sulfonate
PubChem CID101324984
Molecular FormulaC18H23NaO3S
Molecular Weight342.44 g/mol
Exact Mass342.13
IUPAC Namesodium 3,8-dibutylnaphthalene-2-sulfonate
SMILESCCCCc1cc2cccc(CCCC)c2cc1S(=O)(=O)[O-].[Na+]
InChIInChI=1S/C18H24O3S.Na/c1-3-5-8-14-10-7-11-15-12-16(9-6-4-2)18(13-17(14)15)22(19,20)21;/h7,10-13H,3-6,8-9H2,1-2H3,(H,19,20,21);/q;+1/p-1
InChIKeyRIZZTXOIDNCRPO-UHFFFAOYSA-M
XLogP1.43
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.44
LogP ≤ 51.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 3,8-dibutylnaphthalene-2-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

calcium bis(3,8-dibutylnaphthalene-2-sulfonate)
CID 101325277
barium(2+);bis(3,8-diheptylnaphthalene-2-sulfonate)
CID 101319444
sodium 3,5-didodecylnaphthalene-2-sulfonate
CID 101325148
calcium bis(3,8-dipropylnaphthalene-2-sulfonate)
CID 101325256
potassium 8-butylnaphthalene-2-sulfonate
CID 101317133
3,8-didodecylnaphthalene-2-sulfonic acid
CID 101319611
zinc bis(6,7-di(nonyl)naphthalene-1-sulfonate)
CID 101310010
potassium 6,7-dioctylnaphthalene-1-sulfonate
CID 101322605
calcium bis(6,7-dioctylnaphthalene-1-sulfonate)
CID 101324593
potassium 5-tetradecylnaphthalene-2-sulfonate
CID 101317264
sodium 8-tridecylnaphthalene-1-sulfonate
CID 101317063
3,5-dihexylnaphthalene-2-sulfonic acid
CID 101319397

Frequently Asked Questions

What is the IUPAC name of sodium 3,8-dibutylnaphthalene-2-sulfonate?
The IUPAC name of sodium 3,8-dibutylnaphthalene-2-sulfonate (CID 101324984) is sodium 3,8-dibutylnaphthalene-2-sulfonate.
What is the SMILES notation for sodium 3,8-dibutylnaphthalene-2-sulfonate?
The canonical SMILES for sodium 3,8-dibutylnaphthalene-2-sulfonate is CCCCc1cc2cccc(CCCC)c2cc1S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium 3,8-dibutylnaphthalene-2-sulfonate?
The InChIKey is RIZZTXOIDNCRPO-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H24O3S.Na/c1-3-5-8-14-10-7-11-15-12-16(9-6-4-2)18(13-17(14)15)22(19,20)21;/h7,10-13H,3-6,8-9H2,1-2H3,(H,19,20,21);/q;+1/p-1.
What are the key properties of sodium 3,8-dibutylnaphthalene-2-sulfonate?
sodium 3,8-dibutylnaphthalene-2-sulfonate has a molecular weight of 342.44 g/mol, XLogP of 1.43, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3,8-dibutylnaphthalene-2-sulfonate is sourced from PubChem (CID 101324984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).