C40H54CaO6S2 — CID 101317395
calcium bis(8-decylnaphthalene-1-sulfonate) (PubChem CID 101317395) has the molecular formula C40H54CaO6S2 and a molecular weight of 735.08 g/mol. Its IUPAC name is calcium bis(8-decylnaphthalene-1-sulfonate).
| Compound Name | calcium bis(8-decylnaphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 101317395 |
| Molecular Formula | C40H54CaO6S2 |
| Molecular Weight | 735.08 g/mol |
| Exact Mass | 734.30 |
| IUPAC Name | calcium bis(8-decylnaphthalene-1-sulfonate) |
| SMILES | CCCCCCCCCCc1cccc2cccc(S(=O)(=O)[O-])c12.CCCCCCCCCCc1cccc2cccc(S(=O)(=O)[O-])c12.[Ca+2] |
| InChI | InChI=1S/2C20H28O3S.Ca/c2*1-2-3-4-5-6-7-8-9-12-17-13-10-14-18-15-11-16-19(20(17)18)24(21,22)23;/h2*10-11,13-16H,2-9,12H2,1H3,(H,21,22,23);/q;;+2/p-2 |
| InChIKey | GDQGVSSLQIGQNU-UHFFFAOYSA-L |
| XLogP | 10.47 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.08 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|