C44H62CaO6S2 — CID 101324544
calcium bis(3,8-dihexylnaphthalene-1-sulfonate) (PubChem CID 101324544) has the molecular formula C44H62CaO6S2 and a molecular weight of 791.19 g/mol. Its IUPAC name is calcium bis(3,8-dihexylnaphthalene-1-sulfonate).
| Compound Name | calcium bis(3,8-dihexylnaphthalene-1-sulfonate) |
|---|---|
| PubChem CID | 101324544 |
| Molecular Formula | C44H62CaO6S2 |
| Molecular Weight | 791.19 g/mol |
| Exact Mass | 790.36 |
| IUPAC Name | calcium bis(3,8-dihexylnaphthalene-1-sulfonate) |
| SMILES | CCCCCCc1cc(S(=O)(=O)[O-])c2c(CCCCCC)cccc2c1.CCCCCCc1cc(S(=O)(=O)[O-])c2c(CCCCCC)cccc2c1.[Ca+2] |
| InChI | InChI=1S/2C22H32O3S.Ca/c2*1-3-5-7-9-12-18-16-20-15-11-14-19(13-10-8-6-4-2)22(20)21(17-18)26(23,24)25;/h2*11,14-17H,3-10,12-13H2,1-2H3,(H,23,24,25);/q;;+2/p-2 |
| InChIKey | RVKQGFAWBVWKFO-UHFFFAOYSA-L |
| XLogP | 11.60 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.19 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|