About diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate
diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate (PubChem CID 87901254) has the molecular formula C38H26O3S3
and a molecular weight of 626.82 g/mol. Its IUPAC name is diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate.
Molecular Properties
| Compound Name | diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate |
| PubChem CID | 87901254 |
| Molecular Formula | C38H26O3S3 |
| Molecular Weight | 626.82 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2ccc3cccc4ccc1c2c34.c1ccc(-c2ccsc2[S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17S2.C16H10O3S/c1-4-10-18(11-5-1)21-16-17-23-22(21)24(19-12-6-2-7-13-19)20-14-8-3-9-15-20;17-20(18,19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-17H;1-9H,(H,17,18,19)/q+1;/p-1 |
| InChIKey | CBWCZFDDXOFOOQ-UHFFFAOYSA-M |
| XLogP | 10.00 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 626.82 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate?
The IUPAC name of diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate (CID 87901254) is diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate.
What is the SMILES notation for diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate?
The canonical SMILES for diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate is O=S(=O)([O-])c1ccc2ccc3cccc4ccc1c2c34.c1ccc(-c2ccsc2[S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate?
The InChIKey is CBWCZFDDXOFOOQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H17S2.C16H10O3S/c1-4-10-18(11-5-1)21-16-17-23-22(21)24(19-12-6-2-7-13-19)20-14-8-3-9-15-20;17-20(18,19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-17H;1-9H,(H,17,18,19)/q+1;/p-1.
What are the key properties of diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate?
diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate has a molecular weight of 626.82 g/mol, XLogP of 10.00, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-(3-phenylthiophen-2-yl)sulfanium;pyrene-1-sulfonate is sourced from PubChem (CID 87901254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).