About ethene;pyrene-1-sulfonic acid
ethene;pyrene-1-sulfonic acid (PubChem CID 157123261) has the molecular formula C18H14O3S
and a molecular weight of 310.37 g/mol. Its IUPAC name is ethene;pyrene-1-sulfonic acid.
Molecular Properties
| Compound Name | ethene;pyrene-1-sulfonic acid |
| PubChem CID | 157123261 |
| Molecular Formula | C18H14O3S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | ethene;pyrene-1-sulfonic acid |
| SMILES | C=C.O=S(=O)(O)c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C16H10O3S.C2H4/c17-20(18,19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;1-2/h1-9H,(H,17,18,19);1-2H2 |
| InChIKey | AIFLVHBHKAEYFH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethene;pyrene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;pyrene-1-sulfonic acid?
The IUPAC name of ethene;pyrene-1-sulfonic acid (CID 157123261) is ethene;pyrene-1-sulfonic acid.
What is the SMILES notation for ethene;pyrene-1-sulfonic acid?
The canonical SMILES for ethene;pyrene-1-sulfonic acid is C=C.O=S(=O)(O)c1ccc2ccc3cccc4ccc1c2c34.
What is the InChIKey of ethene;pyrene-1-sulfonic acid?
The InChIKey is AIFLVHBHKAEYFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O3S.C2H4/c17-20(18,19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11;1-2/h1-9H,(H,17,18,19);1-2H2.
What are the key properties of ethene;pyrene-1-sulfonic acid?
ethene;pyrene-1-sulfonic acid has a molecular weight of 310.37 g/mol, XLogP of 4.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;pyrene-1-sulfonic acid is sourced from PubChem (CID 157123261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).