C34H26O3S — CID 174280947
pyrene-1-sulfonic acid;1,2,3,4-tetrahydrochrysene (PubChem CID 174280947) has the molecular formula C34H26O3S and a molecular weight of 514.65 g/mol. Its IUPAC name is pyrene-1-sulfonic acid;1,2,3,4-tetrahydrochrysene.
| Compound Name | pyrene-1-sulfonic acid;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174280947 |
| Molecular Formula | C34H26O3S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | pyrene-1-sulfonic acid;1,2,3,4-tetrahydrochrysene |
| SMILES | O=S(=O)(O)c1ccc2ccc3cccc4ccc1c2c34.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C16H10O3S/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;17-20(18,19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1,3,5,7,9-12H,2,4,6,8H2;1-9H,(H,17,18,19) |
| InChIKey | OMSOSRMMFYNXNE-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|