C23H26O2 — CID 174551823
1-hydroxypentan-2-one;1,2,3,4-tetrahydrochrysene (PubChem CID 174551823) has the molecular formula C23H26O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-hydroxypentan-2-one;1,2,3,4-tetrahydrochrysene.
| Compound Name | 1-hydroxypentan-2-one;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174551823 |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 1-hydroxypentan-2-one;1,2,3,4-tetrahydrochrysene |
| SMILES | CCCC(=O)CO.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C5H10O2/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-2-3-5(7)4-6/h1,3,5,7,9-12H,2,4,6,8H2;6H,2-4H2,1H3 |
| InChIKey | NBFZMRPMGCFBLK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|