C26H34Cl3Si — CID 174744465
CID 174744465 (PubChem CID 174744465) has the molecular formula C26H34Cl3Si and a molecular weight of 481.00 g/mol.
| Compound Name | CID 174744465 |
|---|---|
| PubChem CID | 174744465 |
| Molecular Formula | C26H34Cl3Si |
| Molecular Weight | 481.00 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | — |
| SMILES | CCCCCCCC.Cl[Si](Cl)Cl.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C8H18.Cl3Si/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-3-5-7-8-6-4-2;1-4(2)3/h1,3,5,7,9-12H,2,4,6,8H2;3-8H2,1-2H3; |
| InChIKey | ZTTBDTZZIAZMSO-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.00 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|