C34H52O3Si — CID 174495782
decyl(triethoxy)silane;1,2,3,4-tetrahydrochrysene (PubChem CID 174495782) has the molecular formula C34H52O3Si and a molecular weight of 536.87 g/mol. Its IUPAC name is decyl(triethoxy)silane;1,2,3,4-tetrahydrochrysene.
| Compound Name | decyl(triethoxy)silane;1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174495782 |
| Molecular Formula | C34H52O3Si |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | decyl(triethoxy)silane;1,2,3,4-tetrahydrochrysene |
| SMILES | CCCCCCCCCC[Si](OCC)(OCC)OCC.c1ccc2c(c1)ccc1c3c(ccc12)CCCC3 |
| InChI | InChI=1S/C18H16.C16H36O3Si/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-5-9-10-11-12-13-14-15-16-20(17-6-2,18-7-3)19-8-4/h1,3,5,7,9-12H,2,4,6,8H2;5-16H2,1-4H3 |
| InChIKey | KCMBIQYDDXRMCO-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|