C34H50O3Si — CID 174887506
decyl(triethoxy)silane;1,2-dihydrochrysene (PubChem CID 174887506) has the molecular formula C34H50O3Si and a molecular weight of 534.86 g/mol. Its IUPAC name is decyl(triethoxy)silane;1,2-dihydrochrysene.
| Compound Name | decyl(triethoxy)silane;1,2-dihydrochrysene |
|---|---|
| PubChem CID | 174887506 |
| Molecular Formula | C34H50O3Si |
| Molecular Weight | 534.86 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | decyl(triethoxy)silane;1,2-dihydrochrysene |
| SMILES | C1=Cc2c(ccc3c2ccc2ccccc23)CC1.CCCCCCCCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C18H14.C16H36O3Si/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18;1-5-9-10-11-12-13-14-15-16-20(17-6-2,18-7-3)19-8-4/h1,3-5,7-12H,2,6H2;5-16H2,1-4H3 |
| InChIKey | BBJOCPLDCFCJBZ-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.86 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|