C19H16 — CID 143566629
6-methyl-1,2-dihydrochrysene (PubChem CID 143566629) has the molecular formula C19H16 and a molecular weight of 244.34 g/mol. Its IUPAC name is 6-methyl-1,2-dihydrochrysene.
| Compound Name | 6-methyl-1,2-dihydrochrysene |
|---|---|
| PubChem CID | 143566629 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 6-methyl-1,2-dihydrochrysene |
| SMILES | Cc1cc2c3c(ccc2c2ccccc12)CCC=C3 |
| InChI | InChI=1S/C19H16/c1-13-12-19-16-8-3-2-6-14(16)10-11-18(19)17-9-5-4-7-15(13)17/h3-5,7-12H,2,6H2,1H3 |
| InChIKey | LHWCISMBVOGPQQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|