C21H16 — CID 102057755
6-methylpentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2,4,6,8,10,12,14,18-nonaene (PubChem CID 102057755) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is 6-methylpentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2,4,6,8,10,12,14,18-nonaene.
| Compound Name | 6-methylpentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2,4,6,8,10,12,14,18-nonaene |
|---|---|
| PubChem CID | 102057755 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 6-methylpentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(20),2,4,6,8,10,12,14,18-nonaene |
| SMILES | Cc1cccc2c1cc1c3c(c4c(cc32)CCC=C4)C=C1 |
| InChI | InChI=1S/C21H16/c1-13-5-4-8-17-19(13)12-15-9-10-18-16-7-3-2-6-14(16)11-20(17)21(15)18/h3-5,7-12H,2,6H2,1H3 |
| InChIKey | CFHRHJFJMOUZRC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|