C21H18 — CID 102264978
1,5,12-trimethyltriphenylene (PubChem CID 102264978) has the molecular formula C21H18 and a molecular weight of 270.38 g/mol. Its IUPAC name is 1,5,12-trimethyltriphenylene.
| Compound Name | 1,5,12-trimethyltriphenylene |
|---|---|
| PubChem CID | 102264978 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1,5,12-trimethyltriphenylene |
| SMILES | Cc1cccc2c3cccc(C)c3c3c(C)cccc3c12 |
| InChI | InChI=1S/C21H18/c1-13-7-4-10-16-17-11-5-8-14(2)20(17)21-15(3)9-6-12-18(21)19(13)16/h4-12H,1-3H3 |
| InChIKey | QRHOVPNVZORZDH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|