About 1,5,12-trimethyltriphenylene
1,5,12-trimethyltriphenylene (PubChem CID 102264978) has the molecular formula C21H18
and a molecular weight of 270.38 g/mol. Its IUPAC name is 1,5,12-trimethyltriphenylene.
Molecular Properties
| Compound Name | 1,5,12-trimethyltriphenylene |
| PubChem CID | 102264978 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1,5,12-trimethyltriphenylene |
| SMILES | Cc1cccc2c3cccc(C)c3c3c(C)cccc3c12 |
| InChI | InChI=1S/C21H18/c1-13-7-4-10-16-17-11-5-8-14(2)20(17)21-15(3)9-6-12-18(21)19(13)16/h4-12H,1-3H3 |
| InChIKey | QRHOVPNVZORZDH-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,5,12-trimethyltriphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,12-trimethyltriphenylene?
The IUPAC name of 1,5,12-trimethyltriphenylene (CID 102264978) is 1,5,12-trimethyltriphenylene.
What is the SMILES notation for 1,5,12-trimethyltriphenylene?
The canonical SMILES for 1,5,12-trimethyltriphenylene is Cc1cccc2c3cccc(C)c3c3c(C)cccc3c12.
What is the InChIKey of 1,5,12-trimethyltriphenylene?
The InChIKey is QRHOVPNVZORZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18/c1-13-7-4-10-16-17-11-5-8-14(2)20(17)21-15(3)9-6-12-18(21)19(13)16/h4-12H,1-3H3.
What are the key properties of 1,5,12-trimethyltriphenylene?
1,5,12-trimethyltriphenylene has a molecular weight of 270.38 g/mol, XLogP of 6.07, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,12-trimethyltriphenylene is sourced from PubChem (CID 102264978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).