C15H15N2+ — CID 123855150
6,7-dimethylphenanthridin-5-ium-5-amine (PubChem CID 123855150) has the molecular formula C15H15N2+ and a molecular weight of 223.30 g/mol. Its IUPAC name is 6,7-dimethylphenanthridin-5-ium-5-amine.
| Compound Name | 6,7-dimethylphenanthridin-5-ium-5-amine |
|---|---|
| PubChem CID | 123855150 |
| Molecular Formula | C15H15N2+ |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 6,7-dimethylphenanthridin-5-ium-5-amine |
| SMILES | Cc1cccc2c1c(C)[n+](N)c1ccccc21 |
| InChI | InChI=1S/C15H15N2/c1-10-6-5-8-13-12-7-3-4-9-14(12)17(16)11(2)15(10)13/h3-9H,16H2,1-2H3/q+1 |
| InChIKey | ICKPZCXWCYKRMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|