About 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium
1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium (PubChem CID 155616035) has the molecular formula C23H19N2+
and a molecular weight of 323.42 g/mol. Its IUPAC name is 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium.
Molecular Properties
| Compound Name | 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium |
| PubChem CID | 155616035 |
| Molecular Formula | C23H19N2+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium |
| SMILES | Cc1cccc2c3ccccc3[n+]3cc(-c4ccccc4)n(C)c3c12 |
| InChI | InChI=1S/C23H19N2/c1-16-9-8-13-19-18-12-6-7-14-20(18)25-15-21(17-10-4-3-5-11-17)24(2)23(25)22(16)19/h3-15H,1-2H3/q+1 |
| InChIKey | ZJXCZJOQHQQFNO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium?
The IUPAC name of 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium (CID 155616035) is 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium.
What is the SMILES notation for 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium?
The canonical SMILES for 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium is Cc1cccc2c3ccccc3[n+]3cc(-c4ccccc4)n(C)c3c12.
What is the InChIKey of 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium?
The InChIKey is ZJXCZJOQHQQFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N2/c1-16-9-8-13-19-18-12-6-7-14-20(18)25-15-21(17-10-4-3-5-11-17)24(2)23(25)22(16)19/h3-15H,1-2H3/q+1.
What are the key properties of 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium?
1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium has a molecular weight of 323.42 g/mol, XLogP of 5.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,12-dimethyl-2-phenylimidazo[1,2-f]phenanthridin-4-ium is sourced from PubChem (CID 155616035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).