C22H25N2+ — CID 140940411
2-methyl-1,12-di(propan-2-yl)imidazo[1,2-f]phenanthridin-4-ium (PubChem CID 140940411) has the molecular formula C22H25N2+ and a molecular weight of 317.46 g/mol. Its IUPAC name is 2-methyl-1,12-di(propan-2-yl)imidazo[1,2-f]phenanthridin-4-ium.
| Compound Name | 2-methyl-1,12-di(propan-2-yl)imidazo[1,2-f]phenanthridin-4-ium |
|---|---|
| PubChem CID | 140940411 |
| Molecular Formula | C22H25N2+ |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 2-methyl-1,12-di(propan-2-yl)imidazo[1,2-f]phenanthridin-4-ium |
| SMILES | Cc1c[n+]2c3ccccc3c3cccc(C(C)C)c3c2n1C(C)C |
| InChI | InChI=1S/C22H25N2/c1-14(2)17-10-8-11-19-18-9-6-7-12-20(18)23-13-16(5)24(15(3)4)22(23)21(17)19/h6-15H,1-5H3/q+1 |
| InChIKey | DCBVUSYJECGRFN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|