C29H31N2+ — CID 140940532
2-methyl-3-phenyl-1,12-di(propan-2-yl)-8-(trideuteriomethyl)imidazo[1,2-f]phenanthridin-4-ium (PubChem CID 140940532) has the molecular formula C29H31N2+ and a molecular weight of 410.60 g/mol. Its IUPAC name is 2-methyl-3-phenyl-1,12-di(propan-2-yl)-8-(trideuteriomethyl)imidazo[1,2-f]phenanthridin-4-ium.
| Compound Name | 2-methyl-3-phenyl-1,12-di(propan-2-yl)-8-(trideuteriomethyl)imidazo[1,2-f]phenanthridin-4-ium |
|---|---|
| PubChem CID | 140940532 |
| Molecular Formula | C29H31N2+ |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 2-methyl-3-phenyl-1,12-di(propan-2-yl)-8-(trideuteriomethyl)imidazo[1,2-f]phenanthridin-4-ium |
| SMILES | [2H]C([2H])([2H])c1cccc2c1c1cccc(C(C)C)c1c1n(C(C)C)c(C)c(-c3ccccc3)[n+]21 |
| InChI | InChI=1S/C29H31N2/c1-18(2)23-15-11-16-24-26-20(5)12-10-17-25(26)31-28(22-13-8-7-9-14-22)21(6)30(19(3)4)29(31)27(23)24/h7-19H,1-6H3/q+1/i5D3 |
| InChIKey | FAQBPFTVHCKXEQ-VPYROQPTSA-N |
| XLogP | 7.52 |
| TPSA | 9.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|