C29H39N2OSi+ — CID 140940419
10-methyl-6,9,12,12-tetra(propan-2-yl)-17-(trideuteriomethyl)-13-oxa-9-aza-19-azonia-12-silapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2(7),3,5,8(19),10,14(18),15-octaene (PubChem CID 140940419) has the molecular formula C29H39N2OSi+ and a molecular weight of 462.75 g/mol. Its IUPAC name is 10-methyl-6,9,12,12-tetra(propan-2-yl)-17-(trideuteriomethyl)-13-oxa-9-aza-19-azonia-12-silapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2(7),3,5,8(19),10,14(18),15-octaene.
| Compound Name | 10-methyl-6,9,12,12-tetra(propan-2-yl)-17-(trideuteriomethyl)-13-oxa-9-aza-19-azonia-12-silapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2(7),3,5,8(19),10,14(18),15-octaene |
|---|---|
| PubChem CID | 140940419 |
| Molecular Formula | C29H39N2OSi+ |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 10-methyl-6,9,12,12-tetra(propan-2-yl)-17-(trideuteriomethyl)-13-oxa-9-aza-19-azonia-12-silapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2(7),3,5,8(19),10,14(18),15-octaene |
| SMILES | [2H]C([2H])([2H])c1ccc2c3c1c1cccc(C(C)C)c1c1n(C(C)C)c(C)c([n+]31)[Si](C(C)C)(C(C)C)O2 |
| InChI | InChI=1S/C29H39N2OSi/c1-16(2)22-12-11-13-23-25-20(9)14-15-24-27(25)31-28(26(22)23)30(17(3)4)21(10)29(31)33(32-24,18(5)6)19(7)8/h11-19H,1-10H3/q+1/i9D3 |
| InChIKey | FHGFMEYURJUBRR-QSCWSVDWSA-N |
| XLogP | 7.22 |
| TPSA | 18.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|