C21H29BN2 — CID 166020394
2-[2,6-di(propan-2-yl)phenyl]-1,3,4-trimethyl-1,3,2-benzodiazaborole (PubChem CID 166020394) has the molecular formula C21H29BN2 and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-1,3,4-trimethyl-1,3,2-benzodiazaborole.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-1,3,4-trimethyl-1,3,2-benzodiazaborole |
|---|---|
| PubChem CID | 166020394 |
| Molecular Formula | C21H29BN2 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-1,3,4-trimethyl-1,3,2-benzodiazaborole |
| SMILES | Cc1cccc2c1N(C)B(c1c(C(C)C)cccc1C(C)C)N2C |
| InChI | InChI=1S/C21H29BN2/c1-14(2)17-11-9-12-18(15(3)4)20(17)22-23(6)19-13-8-10-16(5)21(19)24(22)7/h8-15H,1-7H3 |
| InChIKey | LJCFGFKEIGUWOI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|