C26H35BN3+ — CID 166589230
1,10-dimethyl-5-(2-methyl-6-propan-2-ylphenyl)-6-pentylimidazo[1,2-c][1,3,2]benzodiazaborinin-4-ium (PubChem CID 166589230) has the molecular formula C26H35BN3+ and a molecular weight of 400.40 g/mol. Its IUPAC name is 1,10-dimethyl-5-(2-methyl-6-propan-2-ylphenyl)-6-pentylimidazo[1,2-c][1,3,2]benzodiazaborinin-4-ium.
| Compound Name | 1,10-dimethyl-5-(2-methyl-6-propan-2-ylphenyl)-6-pentylimidazo[1,2-c][1,3,2]benzodiazaborinin-4-ium |
|---|---|
| PubChem CID | 166589230 |
| Molecular Formula | C26H35BN3+ |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | 1,10-dimethyl-5-(2-methyl-6-propan-2-ylphenyl)-6-pentylimidazo[1,2-c][1,3,2]benzodiazaborinin-4-ium |
| SMILES | CCCCCN1B(c2c(C)cccc2C(C)C)[n+]2ccn(C)c2-c2c(C)cccc21 |
| InChI | InChI=1S/C26H35BN3/c1-7-8-9-16-29-23-15-11-12-20(4)24(23)26-28(6)17-18-30(26)27(29)25-21(5)13-10-14-22(25)19(2)3/h10-15,17-19H,7-9,16H2,1-6H3/q+1 |
| InChIKey | BDHXAJKQUVWBSI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|