C26H25BN3+ — CID 166589316
14,20,23-trimethyl-1,20-diaza-17-azonia-16-borahexacyclo[14.11.0.02,7.010,15.017,21.022,27]heptacosa-2,4,6,10,12,14,17(21),18,22,24,26-undecaene (PubChem CID 166589316) has the molecular formula C26H25BN3+ and a molecular weight of 390.32 g/mol. Its IUPAC name is 14,20,23-trimethyl-1,20-diaza-17-azonia-16-borahexacyclo[14.11.0.02,7.010,15.017,21.022,27]heptacosa-2,4,6,10,12,14,17(21),18,22,24,26-undecaene.
| Compound Name | 14,20,23-trimethyl-1,20-diaza-17-azonia-16-borahexacyclo[14.11.0.02,7.010,15.017,21.022,27]heptacosa-2,4,6,10,12,14,17(21),18,22,24,26-undecaene |
|---|---|
| PubChem CID | 166589316 |
| Molecular Formula | C26H25BN3+ |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 14,20,23-trimethyl-1,20-diaza-17-azonia-16-borahexacyclo[14.11.0.02,7.010,15.017,21.022,27]heptacosa-2,4,6,10,12,14,17(21),18,22,24,26-undecaene |
| SMILES | Cc1cccc2c1B1N(c3ccccc3CC2)c2cccc(C)c2-c2n(C)cc[n+]21 |
| InChI | InChI=1S/C26H25BN3/c1-18-8-7-13-23-24(18)26-28(3)16-17-29(26)27-25-19(2)9-6-11-21(25)15-14-20-10-4-5-12-22(20)30(23)27/h4-13,16-17H,14-15H2,1-3H3/q+1 |
| InChIKey | TTYFPZBMODRKHT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|