C15H15N — CID 159483382
4,10-dimethyl-9H-acridine (PubChem CID 159483382) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 4,10-dimethyl-9H-acridine.
| Compound Name | 4,10-dimethyl-9H-acridine |
|---|---|
| PubChem CID | 159483382 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4,10-dimethyl-9H-acridine |
| SMILES | Cc1cccc2c1N(C)c1ccccc1C2 |
| InChI | InChI=1S/C15H15N/c1-11-6-5-8-13-10-12-7-3-4-9-14(12)16(2)15(11)13/h3-9H,10H2,1-2H3 |
| InChIKey | BPCDHEJRNZCLEF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |