C16H18N2 — CID 20660475
1,5,6,10-tetramethylphenazine (PubChem CID 20660475) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1,5,6,10-tetramethylphenazine.
| Compound Name | 1,5,6,10-tetramethylphenazine |
|---|---|
| PubChem CID | 20660475 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 1,5,6,10-tetramethylphenazine |
| SMILES | Cc1cccc2c1N(C)c1cccc(C)c1N2C |
| InChI | InChI=1S/C16H18N2/c1-11-7-5-9-13-15(11)17(3)14-10-6-8-12(2)16(14)18(13)4/h5-10H,1-4H3 |
| InChIKey | GRRIUXHRHPEHQM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |