C12H15F2NO — CID 164860376
3,3-difluoro-1,4-dimethylindol-2-one;ethane (PubChem CID 164860376) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 3,3-difluoro-1,4-dimethylindol-2-one;ethane.
| Compound Name | 3,3-difluoro-1,4-dimethylindol-2-one;ethane |
|---|---|
| PubChem CID | 164860376 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 3,3-difluoro-1,4-dimethylindol-2-one;ethane |
| SMILES | CC.Cc1cccc2c1C(F)(F)C(=O)N2C |
| InChI | InChI=1S/C10H9F2NO.C2H6/c1-6-4-3-5-7-8(6)10(11,12)9(14)13(7)2;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | JCKBAAIPGMDCJK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |