C23H33NOSi2 — CID 138970889
1,4-dimethyl-3-(trimethylsilylmethyl)-3-(2-trimethylsilylphenyl)indol-2-one (PubChem CID 138970889) has the molecular formula C23H33NOSi2 and a molecular weight of 395.70 g/mol. Its IUPAC name is 1,4-dimethyl-3-(trimethylsilylmethyl)-3-(2-trimethylsilylphenyl)indol-2-one.
| Compound Name | 1,4-dimethyl-3-(trimethylsilylmethyl)-3-(2-trimethylsilylphenyl)indol-2-one |
|---|---|
| PubChem CID | 138970889 |
| Molecular Formula | C23H33NOSi2 |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1,4-dimethyl-3-(trimethylsilylmethyl)-3-(2-trimethylsilylphenyl)indol-2-one |
| SMILES | Cc1cccc2c1C(C[Si](C)(C)C)(c1ccccc1[Si](C)(C)C)C(=O)N2C |
| InChI | InChI=1S/C23H33NOSi2/c1-17-12-11-14-19-21(17)23(16-26(3,4)5,22(25)24(19)2)18-13-9-10-15-20(18)27(6,7)8/h9-15H,16H2,1-8H3 |
| InChIKey | PFSYKMFYVGDRST-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|