C16H22N2O3Si — CID 102430781
(4R,6S)-1'-methyl-6-(trimethylsilylmethyl)spiro[1,3-oxazinane-4,3'-indole]-2,2'-dione (PubChem CID 102430781) has the molecular formula C16H22N2O3Si and a molecular weight of 318.45 g/mol. Its IUPAC name is (4R,6S)-1'-methyl-6-(trimethylsilylmethyl)spiro[1,3-oxazinane-4,3'-indole]-2,2'-dione.
| Compound Name | (4R,6S)-1'-methyl-6-(trimethylsilylmethyl)spiro[1,3-oxazinane-4,3'-indole]-2,2'-dione |
|---|---|
| PubChem CID | 102430781 |
| Molecular Formula | C16H22N2O3Si |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (4R,6S)-1'-methyl-6-(trimethylsilylmethyl)spiro[1,3-oxazinane-4,3'-indole]-2,2'-dione |
| SMILES | CN1C(=O)[C@@]2(C[C@@H](C[Si](C)(C)C)OC(=O)N2)c2ccccc21 |
| InChI | InChI=1S/C16H22N2O3Si/c1-18-13-8-6-5-7-12(13)16(14(18)19)9-11(10-22(2,3)4)21-15(20)17-16/h5-8,11H,9-10H2,1-4H3,(H,17,20)/t11-,16+/m0/s1 |
| InChIKey | YFMAKHUZZRLKAF-MEDUHNTESA-N |
| XLogP | 2.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|