C18H16N2O2S — CID 102097042
(4S,5S)-1'-methyl-5-(4-methylphenyl)-2-sulfanylidenespiro[1,3-oxazolidine-4,3'-indole]-2'-one (PubChem CID 102097042) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is (4S,5S)-1'-methyl-5-(4-methylphenyl)-2-sulfanylidenespiro[1,3-oxazolidine-4,3'-indole]-2'-one.
| Compound Name | (4S,5S)-1'-methyl-5-(4-methylphenyl)-2-sulfanylidenespiro[1,3-oxazolidine-4,3'-indole]-2'-one |
|---|---|
| PubChem CID | 102097042 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (4S,5S)-1'-methyl-5-(4-methylphenyl)-2-sulfanylidenespiro[1,3-oxazolidine-4,3'-indole]-2'-one |
| SMILES | Cc1ccc([C@@H]2OC(=S)N[C@]23C(=O)N(C)c2ccccc23)cc1 |
| InChI | InChI=1S/C18H16N2O2S/c1-11-7-9-12(10-8-11)15-18(19-17(23)22-15)13-5-3-4-6-14(13)20(2)16(18)21/h3-10,15H,1-2H3,(H,19,23)/t15-,18-/m0/s1 |
| InChIKey | POWCZBMQBFRSQB-YJBOKZPZSA-N |
| XLogP | 2.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|